C26H28N2O2 — CID 95352112
(3S)-N-[(1S)-1-naphthalen-2-ylethyl]-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 95352112) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (3S)-N-[(1S)-1-naphthalen-2-ylethyl]-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(1S)-1-naphthalen-2-ylethyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95352112 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (3S)-N-[(1S)-1-naphthalen-2-ylethyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1CCCN(C(=O)Cc2ccccc2)C1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H28N2O2/c1-19(22-14-13-21-10-5-6-11-23(21)17-22)27-26(30)24-12-7-15-28(18-24)25(29)16-20-8-3-2-4-9-20/h2-6,8-11,13-14,17,19,24H,7,12,15-16,18H2,1H3,(H,27,30)/t19-,24-/m0/s1 |
| InChIKey | NOIYNPZQMJBVBX-CYFREDJKSA-N |
| XLogP | 4.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |