C27H34F2N2O4 — CID 55747317
1-(2,4-difluorobenzoyl)-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 55747317) has the molecular formula C27H34F2N2O4 and a molecular weight of 488.58 g/mol. Its IUPAC name is 1-(2,4-difluorobenzoyl)-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,4-difluorobenzoyl)-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55747317 |
| Molecular Formula | C27H34F2N2O4 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 1-(2,4-difluorobenzoyl)-N-[1-(3-methoxy-4-pentoxyphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CCCCCOc1ccc(C(C)NC(=O)C2CCN(C(=O)c3ccc(F)cc3F)CC2)cc1OC |
| InChI | InChI=1S/C27H34F2N2O4/c1-4-5-6-15-35-24-10-7-20(16-25(24)34-3)18(2)30-26(32)19-11-13-31(14-12-19)27(33)22-9-8-21(28)17-23(22)29/h7-10,16-19H,4-6,11-15H2,1-3H3,(H,30,32) |
| InChIKey | IWRYIRGXTHWZOL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|