C26H31F2NO4 — CID 55748083
(2,5-difluorophenyl)-[1-(4-hexoxy-3-methoxybenzoyl)piperidin-4-yl]methanone (PubChem CID 55748083) has the molecular formula C26H31F2NO4 and a molecular weight of 459.53 g/mol. Its IUPAC name is (2,5-difluorophenyl)-[1-(4-hexoxy-3-methoxybenzoyl)piperidin-4-yl]methanone.
| Compound Name | (2,5-difluorophenyl)-[1-(4-hexoxy-3-methoxybenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55748083 |
| Molecular Formula | C26H31F2NO4 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (2,5-difluorophenyl)-[1-(4-hexoxy-3-methoxybenzoyl)piperidin-4-yl]methanone |
| SMILES | CCCCCCOc1ccc(C(=O)N2CCC(C(=O)c3cc(F)ccc3F)CC2)cc1OC |
| InChI | InChI=1S/C26H31F2NO4/c1-3-4-5-6-15-33-23-10-7-19(16-24(23)32-2)26(31)29-13-11-18(12-14-29)25(30)21-17-20(27)8-9-22(21)28/h7-10,16-18H,3-6,11-15H2,1-2H3 |
| InChIKey | XYZSXVZYWDZOMT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|