C24H39N3O6S — CID 55601246
[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]-(4-hexoxy-3-methoxyphenyl)methanone (PubChem CID 55601246) has the molecular formula C24H39N3O6S and a molecular weight of 497.66 g/mol. Its IUPAC name is [4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]-(4-hexoxy-3-methoxyphenyl)methanone.
| Compound Name | [4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]-(4-hexoxy-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 55601246 |
| Molecular Formula | C24H39N3O6S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | [4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]-(4-hexoxy-3-methoxyphenyl)methanone |
| SMILES | CCCCCCOc1ccc(C(=O)N2CCN(S(=O)(=O)N3CC(C)OC(C)C3)CC2)cc1OC |
| InChI | InChI=1S/C24H39N3O6S/c1-5-6-7-8-15-32-22-10-9-21(16-23(22)31-4)24(28)25-11-13-26(14-12-25)34(29,30)27-17-19(2)33-20(3)18-27/h9-10,16,19-20H,5-8,11-15,17-18H2,1-4H3 |
| InChIKey | TXSHLVMMVAKPRB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|