C17H33N3O5S — CID 48675846
2-butoxy-1-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 48675846) has the molecular formula C17H33N3O5S and a molecular weight of 391.53 g/mol. Its IUPAC name is 2-butoxy-1-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 2-butoxy-1-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 48675846 |
| Molecular Formula | C17H33N3O5S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-butoxy-1-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | CCCCOC(C)C(=O)N1CCN(S(=O)(=O)N2CC(C)OC(C)C2)CC1 |
| InChI | InChI=1S/C17H33N3O5S/c1-5-6-11-24-16(4)17(21)18-7-9-19(10-8-18)26(22,23)20-12-14(2)25-15(3)13-20/h14-16H,5-13H2,1-4H3 |
| InChIKey | SEYIKOGXGDAGBV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|