C16H30N2O3 — CID 95758847
(2R)-2-butoxy-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]propan-1-one (PubChem CID 95758847) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is (2R)-2-butoxy-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]propan-1-one.
| Compound Name | (2R)-2-butoxy-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95758847 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (2R)-2-butoxy-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]propan-1-one |
| SMILES | CCCCO[C@H](C)C(=O)N1CCN([C@H]2CCC[C@@H]2O)CC1 |
| InChI | InChI=1S/C16H30N2O3/c1-3-4-12-21-13(2)16(20)18-10-8-17(9-11-18)14-6-5-7-15(14)19/h13-15,19H,3-12H2,1-2H3/t13-,14+,15+/m1/s1 |
| InChIKey | JLTVDIQBXJOVFE-ILXRZTDVSA-N |
| XLogP | 1.25 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|