About (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one
(2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one (PubChem CID 97005626) has the molecular formula C19H28N2O2
and a molecular weight of 316.44 g/mol. Its IUPAC name is (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one.
Molecular Properties
| Compound Name | (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one |
| PubChem CID | 97005626 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc([C@H](C)C(=O)N2CCN([C@H]3CCC[C@@H]3O)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-14-6-8-16(9-7-14)15(2)19(23)21-12-10-20(11-13-21)17-4-3-5-18(17)22/h6-9,15,17-18,22H,3-5,10-13H2,1-2H3/t15-,17-,18-/m0/s1 |
| InChIKey | NWLQTERQUMABPV-SZMVWBNQSA-N |
| XLogP | 2.16 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one?
The IUPAC name of (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one (CID 97005626) is (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one.
What is the SMILES notation for (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one?
The canonical SMILES for (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one is Cc1ccc([C@H](C)C(=O)N2CCN([C@H]3CCC[C@@H]3O)CC2)cc1.
What is the InChIKey of (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one?
The InChIKey is NWLQTERQUMABPV-SZMVWBNQSA-N. The full InChI is InChI=1S/C19H28N2O2/c1-14-6-8-16(9-7-14)15(2)19(23)21-12-10-20(11-13-21)17-4-3-5-18(17)22/h6-9,15,17-18,22H,3-5,10-13H2,1-2H3/t15-,17-,18-/m0/s1.
What are the key properties of (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one?
(2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one has a molecular weight of 316.44 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[4-[(1S,2S)-2-hydroxycyclopentyl]piperazin-1-yl]-2-(4-methylphenyl)propan-1-one is sourced from PubChem (CID 97005626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).