C17H23F2N3O2 — CID 119506667
1-(2,4-difluorobenzoyl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide (PubChem CID 119506667) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(2,4-difluorobenzoyl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,4-difluorobenzoyl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119506667 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-(2,4-difluorobenzoyl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide |
| SMILES | CCNCCNC(=O)C1CCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H23F2N3O2/c1-2-20-7-8-21-16(23)12-5-9-22(10-6-12)17(24)14-4-3-13(18)11-15(14)19/h3-4,11-12,20H,2,5-10H2,1H3,(H,21,23) |
| InChIKey | OFWYASOOYMVCSA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|