C23H26F2N2O2 — CID 24596971
1-(2,4-difluorobenzoyl)-N-(4-phenylbutyl)piperidine-4-carboxamide (PubChem CID 24596971) has the molecular formula C23H26F2N2O2 and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-(2,4-difluorobenzoyl)-N-(4-phenylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,4-difluorobenzoyl)-N-(4-phenylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24596971 |
| Molecular Formula | C23H26F2N2O2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-(2,4-difluorobenzoyl)-N-(4-phenylbutyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)C1CCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C23H26F2N2O2/c24-19-9-10-20(21(25)16-19)23(29)27-14-11-18(12-15-27)22(28)26-13-5-4-8-17-6-2-1-3-7-17/h1-3,6-7,9-10,16,18H,4-5,8,11-15H2,(H,26,28) |
| InChIKey | FJQCECVZXBZDIQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|