C23H26F2N2O4 — CID 46434484
1-(2,4-difluorobenzoyl)-N-[[4-(2-methoxyethoxy)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 46434484) has the molecular formula C23H26F2N2O4 and a molecular weight of 432.47 g/mol. Its IUPAC name is 1-(2,4-difluorobenzoyl)-N-[[4-(2-methoxyethoxy)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,4-difluorobenzoyl)-N-[[4-(2-methoxyethoxy)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46434484 |
| Molecular Formula | C23H26F2N2O4 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-(2,4-difluorobenzoyl)-N-[[4-(2-methoxyethoxy)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | COCCOc1ccc(CNC(=O)C2CCN(C(=O)c3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C23H26F2N2O4/c1-30-12-13-31-19-5-2-16(3-6-19)15-26-22(28)17-8-10-27(11-9-17)23(29)20-7-4-18(24)14-21(20)25/h2-7,14,17H,8-13,15H2,1H3,(H,26,28) |
| InChIKey | IDCSSARSFVQHGY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|