C19H27F2N3O2 — CID 119666493
N-(1-aminohexan-2-yl)-1-(2,4-difluorobenzoyl)piperidine-4-carboxamide (PubChem CID 119666493) has the molecular formula C19H27F2N3O2 and a molecular weight of 367.44 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-1-(2,4-difluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(1-aminohexan-2-yl)-1-(2,4-difluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119666493 |
| Molecular Formula | C19H27F2N3O2 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-(1-aminohexan-2-yl)-1-(2,4-difluorobenzoyl)piperidine-4-carboxamide |
| SMILES | CCCCC(CN)NC(=O)C1CCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H27F2N3O2/c1-2-3-4-15(12-22)23-18(25)13-7-9-24(10-8-13)19(26)16-6-5-14(20)11-17(16)21/h5-6,11,13,15H,2-4,7-10,12,22H2,1H3,(H,23,25) |
| InChIKey | MNJMEKYFSAFFRU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |