C19H22F2N2O4 — CID 120693182
(E)-2-[[1-(2,4-difluorobenzoyl)piperidine-4-carbonyl]amino]hex-4-enoic acid (PubChem CID 120693182) has the molecular formula C19H22F2N2O4 and a molecular weight of 380.39 g/mol. Its IUPAC name is (E)-2-[[1-(2,4-difluorobenzoyl)piperidine-4-carbonyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[1-(2,4-difluorobenzoyl)piperidine-4-carbonyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693182 |
| Molecular Formula | C19H22F2N2O4 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (E)-2-[[1-(2,4-difluorobenzoyl)piperidine-4-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)C1CCN(C(=O)c2ccc(F)cc2F)CC1)C(=O)O |
| InChI | InChI=1S/C19H22F2N2O4/c1-2-3-4-16(19(26)27)22-17(24)12-7-9-23(10-8-12)18(25)14-6-5-13(20)11-15(14)21/h2-3,5-6,11-12,16H,4,7-10H2,1H3,(H,22,24)(H,26,27)/b3-2+ |
| InChIKey | QTQFGHXGAXJIRZ-NSCUHMNNSA-N |
| XLogP | 2.35 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|