C23H30F2N2O4 — CID 91737604
butyl 1-[1-(2,4-difluorobenzoyl)piperidine-4-carbonyl]piperidine-4-carboxylate (PubChem CID 91737604) has the molecular formula C23H30F2N2O4 and a molecular weight of 436.50 g/mol. Its IUPAC name is butyl 1-[1-(2,4-difluorobenzoyl)piperidine-4-carbonyl]piperidine-4-carboxylate.
| Compound Name | butyl 1-[1-(2,4-difluorobenzoyl)piperidine-4-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91737604 |
| Molecular Formula | C23H30F2N2O4 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | butyl 1-[1-(2,4-difluorobenzoyl)piperidine-4-carbonyl]piperidine-4-carboxylate |
| SMILES | CCCCOC(=O)C1CCN(C(=O)C2CCN(C(=O)c3ccc(F)cc3F)CC2)CC1 |
| InChI | InChI=1S/C23H30F2N2O4/c1-2-3-14-31-23(30)17-8-12-26(13-9-17)21(28)16-6-10-27(11-7-16)22(29)19-5-4-18(24)15-20(19)25/h4-5,15-17H,2-3,6-14H2,1H3 |
| InChIKey | VZDSJQKMPHEYRF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|