C17H20F2N2O2 — CID 78803342
[1-(2,4-difluorobenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 78803342) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.35 g/mol. Its IUPAC name is [1-(2,4-difluorobenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-(2,4-difluorobenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 78803342 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [1-(2,4-difluorobenzoyl)piperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(F)cc1F)N1CCC(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C17H20F2N2O2/c18-13-3-4-14(15(19)11-13)17(23)21-9-5-12(6-10-21)16(22)20-7-1-2-8-20/h3-4,11-12H,1-2,5-10H2 |
| InChIKey | PMAMWFORETVTBU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |