C18H23F2N3O2 — CID 119379144
(3-aminopiperidin-1-yl)-[1-(2,4-difluorobenzoyl)piperidin-4-yl]methanone (PubChem CID 119379144) has the molecular formula C18H23F2N3O2 and a molecular weight of 351.40 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[1-(2,4-difluorobenzoyl)piperidin-4-yl]methanone.
| Compound Name | (3-aminopiperidin-1-yl)-[1-(2,4-difluorobenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 119379144 |
| Molecular Formula | C18H23F2N3O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[1-(2,4-difluorobenzoyl)piperidin-4-yl]methanone |
| SMILES | NC1CCCN(C(=O)C2CCN(C(=O)c3ccc(F)cc3F)CC2)C1 |
| InChI | InChI=1S/C18H23F2N3O2/c19-13-3-4-15(16(20)10-13)18(25)22-8-5-12(6-9-22)17(24)23-7-1-2-14(21)11-23/h3-4,10,12,14H,1-2,5-9,11,21H2 |
| InChIKey | LKTUKNQYWRAELJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |