C11H12F2N2O — CID 62069041
(3-aminopyrrolidin-1-yl)-(2,4-difluorophenyl)methanone (PubChem CID 62069041) has the molecular formula C11H12F2N2O and a molecular weight of 226.23 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(2,4-difluorophenyl)methanone.
| Compound Name | (3-aminopyrrolidin-1-yl)-(2,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 62069041 |
| Molecular Formula | C11H12F2N2O |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(2,4-difluorophenyl)methanone |
| SMILES | NC1CCN(C(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C11H12F2N2O/c12-7-1-2-9(10(13)5-7)11(16)15-4-3-8(14)6-15/h1-2,5,8H,3-4,6,14H2 |
| InChIKey | RKCSLSBZNLRFAU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |