C18H21F4NO3 — CID 176700728
N-[2-[2-(5-fluoro-2-prop-1-en-2-ylphenoxy)ethoxy]ethyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide (PubChem CID 176700728) has the molecular formula C18H21F4NO3 and a molecular weight of 375.36 g/mol. Its IUPAC name is N-[2-[2-(5-fluoro-2-prop-1-en-2-ylphenoxy)ethoxy]ethyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[2-[2-(5-fluoro-2-prop-1-en-2-ylphenoxy)ethoxy]ethyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 176700728 |
| Molecular Formula | C18H21F4NO3 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[2-[2-(5-fluoro-2-prop-1-en-2-ylphenoxy)ethoxy]ethyl]-1-(trifluoromethyl)cyclopropane-1-carboxamide |
| SMILES | C=C(C)c1ccc(F)cc1OCCOCCNC(=O)C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H21F4NO3/c1-12(2)14-4-3-13(19)11-15(14)26-10-9-25-8-7-23-16(24)17(5-6-17)18(20,21)22/h3-4,11H,1,5-10H2,2H3,(H,23,24) |
| InChIKey | HLCNDPSBDHUAKM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|