C21H30FN3O4S — CID 176700405
tert-butyl N-[2-[2-[5-fluoro-2-[(Z)-N-(methylideneamino)-C-(2-methyl-1-sulfanylprop-1-enyl)carbonimidoyl]phenoxy]ethoxy]ethyl]carbamate (PubChem CID 176700405) has the molecular formula C21H30FN3O4S and a molecular weight of 439.55 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[5-fluoro-2-[(Z)-N-(methylideneamino)-C-(2-methyl-1-sulfanylprop-1-enyl)carbonimidoyl]phenoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[5-fluoro-2-[(Z)-N-(methylideneamino)-C-(2-methyl-1-sulfanylprop-1-enyl)carbonimidoyl]phenoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176700405 |
| Molecular Formula | C21H30FN3O4S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | tert-butyl N-[2-[2-[5-fluoro-2-[(Z)-N-(methylideneamino)-C-(2-methyl-1-sulfanylprop-1-enyl)carbonimidoyl]phenoxy]ethoxy]ethyl]carbamate |
| SMILES | C=N/N=C(\C(S)=C(C)C)c1ccc(F)cc1OCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30FN3O4S/c1-14(2)19(30)18(25-23-6)16-8-7-15(22)13-17(16)28-12-11-27-10-9-24-20(26)29-21(3,4)5/h7-8,13,30H,6,9-12H2,1-5H3,(H,24,26)/b25-18- |
| InChIKey | YZZWEEYSSLLEJD-BWAHOGKJSA-N |
| XLogP | 4.37 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|