C20H31FN2O5 — CID 176700697
ethane;1-(prop-2-enoylamino)propan-2-yl N-[2-[2-(5-fluoro-2-methylphenoxy)ethoxy]ethyl]carbamate (PubChem CID 176700697) has the molecular formula C20H31FN2O5 and a molecular weight of 398.48 g/mol. Its IUPAC name is ethane;1-(prop-2-enoylamino)propan-2-yl N-[2-[2-(5-fluoro-2-methylphenoxy)ethoxy]ethyl]carbamate.
| Compound Name | ethane;1-(prop-2-enoylamino)propan-2-yl N-[2-[2-(5-fluoro-2-methylphenoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176700697 |
| Molecular Formula | C20H31FN2O5 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | ethane;1-(prop-2-enoylamino)propan-2-yl N-[2-[2-(5-fluoro-2-methylphenoxy)ethoxy]ethyl]carbamate |
| SMILES | C=CC(=O)NCC(C)OC(=O)NCCOCCOc1cc(F)ccc1C.CC |
| InChI | InChI=1S/C18H25FN2O5.C2H6/c1-4-17(22)21-12-14(3)26-18(23)20-7-8-24-9-10-25-16-11-15(19)6-5-13(16)2;1-2/h4-6,11,14H,1,7-10,12H2,2-3H3,(H,20,23)(H,21,22);1-2H3 |
| InChIKey | YNKJGKLWCUUUMJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|