C17H24FNO2 — CID 176701392
ethane;N-[[1-(5-fluoro-2-methylphenoxy)cyclobutyl]methyl]prop-2-enamide (PubChem CID 176701392) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is ethane;N-[[1-(5-fluoro-2-methylphenoxy)cyclobutyl]methyl]prop-2-enamide.
| Compound Name | ethane;N-[[1-(5-fluoro-2-methylphenoxy)cyclobutyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 176701392 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | ethane;N-[[1-(5-fluoro-2-methylphenoxy)cyclobutyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC1(Oc2cc(F)ccc2C)CCC1.CC |
| InChI | InChI=1S/C15H18FNO2.C2H6/c1-3-14(18)17-10-15(7-4-8-15)19-13-9-12(16)6-5-11(13)2;1-2/h3,5-6,9H,1,4,7-8,10H2,2H3,(H,17,18);1-2H3 |
| InChIKey | DMVLGBBXENCBIY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|