C21H28FIN2O5 — CID 176701164
[(3S,4R)-4-methyl-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[5-fluoro-2-(1-iodoethyl)phenoxy]ethoxy]ethyl]carbamate (PubChem CID 176701164) has the molecular formula C21H28FIN2O5 and a molecular weight of 534.37 g/mol. Its IUPAC name is [(3S,4R)-4-methyl-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[5-fluoro-2-(1-iodoethyl)phenoxy]ethoxy]ethyl]carbamate.
| Compound Name | [(3S,4R)-4-methyl-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[5-fluoro-2-(1-iodoethyl)phenoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176701164 |
| Molecular Formula | C21H28FIN2O5 |
| Molecular Weight | 534.37 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | [(3S,4R)-4-methyl-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[5-fluoro-2-(1-iodoethyl)phenoxy]ethoxy]ethyl]carbamate |
| SMILES | C=CC(=O)N1C[C@@H](C)[C@H](OC(=O)NCCOCCOc2cc(F)ccc2C(C)I)C1 |
| InChI | InChI=1S/C21H28FIN2O5/c1-4-20(26)25-12-14(2)19(13-25)30-21(27)24-7-8-28-9-10-29-18-11-16(22)5-6-17(18)15(3)23/h4-6,11,14-15,19H,1,7-10,12-13H2,2-3H3,(H,24,27)/t14-,15?,19-/m1/s1 |
| InChIKey | UMLQRRCUXXTWPM-NQUBZZJWSA-N |
| XLogP | 3.48 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|