C36H36FN5O5S — CID 176700577
[(3R)-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[5-fluoro-2-[4-(2-prop-2-ynyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]carbamate (PubChem CID 176700577) has the molecular formula C36H36FN5O5S and a molecular weight of 669.78 g/mol. Its IUPAC name is [(3R)-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[5-fluoro-2-[4-(2-prop-2-ynyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]carbamate.
| Compound Name | [(3R)-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[5-fluoro-2-[4-(2-prop-2-ynyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176700577 |
| Molecular Formula | C36H36FN5O5S |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.24 |
| IUPAC Name | [(3R)-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-[5-fluoro-2-[4-(2-prop-2-ynyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]carbamate |
| SMILES | C#CCN1CCc2cc(-c3nnc(-c4ccc(F)cc4OCCOCCNC(=O)O[C@@H]4CCN(C(=O)C=C)C4)c4sccc34)ccc2C1 |
| InChI | InChI=1S/C36H36FN5O5S/c1-3-13-41-14-9-24-20-25(5-6-26(24)22-41)33-30-11-19-48-35(30)34(40-39-33)29-8-7-27(37)21-31(29)46-18-17-45-16-12-38-36(44)47-28-10-15-42(23-28)32(43)4-2/h1,4-8,11,19-21,28H,2,9-10,12-18,22-23H2,(H,38,44)/t28-/m1/s1 |
| InChIKey | ZTNNVOQRGISRRH-MUUNZHRXSA-N |
| XLogP | 5.06 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|