C27H28FN5O4S — CID 176700595
tert-butyl N-[2-[2-[5-fluoro-2-[4-[2-(1-methylpyrazol-4-yl)ethynyl]thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]carbamate (PubChem CID 176700595) has the molecular formula C27H28FN5O4S and a molecular weight of 537.62 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[5-fluoro-2-[4-[2-(1-methylpyrazol-4-yl)ethynyl]thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[5-fluoro-2-[4-[2-(1-methylpyrazol-4-yl)ethynyl]thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176700595 |
| Molecular Formula | C27H28FN5O4S |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | tert-butyl N-[2-[2-[5-fluoro-2-[4-[2-(1-methylpyrazol-4-yl)ethynyl]thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]carbamate |
| SMILES | Cn1cc(C#Cc2nnc(-c3ccc(F)cc3OCCOCCNC(=O)OC(C)(C)C)c3sccc23)cn1 |
| InChI | InChI=1S/C27H28FN5O4S/c1-27(2,3)37-26(34)29-10-11-35-12-13-36-23-15-19(28)6-7-21(23)24-25-20(9-14-38-25)22(31-32-24)8-5-18-16-30-33(4)17-18/h6-7,9,14-17H,10-13H2,1-4H3,(H,29,34) |
| InChIKey | IVNPHGKDEYZVKZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|