C34H36FN5O4S — CID 176701112
cis-(1R,3S)-N-[2-[2-[5-fluoro-2-[4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]-3-(prop-2-enoylamino)cyclopentane-1-carboxamide (PubChem CID 176701112) has the molecular formula C34H36FN5O4S and a molecular weight of 629.76 g/mol. Its IUPAC name is cis-(1R,3S)-N-[2-[2-[5-fluoro-2-[4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]-3-(prop-2-enoylamino)cyclopentane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-[2-[2-[5-fluoro-2-[4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]-3-(prop-2-enoylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 176701112 |
| Molecular Formula | C34H36FN5O4S |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | cis-(1R,3S)-N-[2-[2-[5-fluoro-2-[4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[2,3-d]pyridazin-7-yl]phenoxy]ethoxy]ethyl]-3-(prop-2-enoylamino)cyclopentane-1-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CC[C@@H](C(=O)NCCOCCOc2cc(F)ccc2-c2nnc(-c3ccc4c(c3)CCNC4)c3ccsc23)C1 |
| InChI | InChI=1S/C34H36FN5O4S/c1-2-30(41)38-26-7-5-23(18-26)34(42)37-12-13-43-14-15-44-29-19-25(35)6-8-27(29)32-33-28(10-16-45-33)31(39-40-32)22-3-4-24-20-36-11-9-21(24)17-22/h2-4,6,8,10,16-17,19,23,26,36H,1,5,7,9,11-15,18,20H2,(H,37,42)(H,38,41)/t23-,26+/m1/s1 |
| InChIKey | WBYGIYQJKJJMAS-BVAGGSTKSA-N |
| XLogP | 4.79 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|