C32H28FN5O4S — CID 170097089
N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]methyl]prop-2-enamide (PubChem CID 170097089) has the molecular formula C32H28FN5O4S and a molecular weight of 597.67 g/mol. Its IUPAC name is N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]methyl]prop-2-enamide.
| Compound Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 170097089 |
| Molecular Formula | C32H28FN5O4S |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | N-[[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1-oxo-3,4-dihydro-2H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-1H-pyrazol-5-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(-c2nc(-c3ccc4c(c3)CCNC4=O)c3ccsc3c2-c2ccc(F)cc2OCCOC)n[nH]1 |
| InChI | InChI=1S/C32H28FN5O4S/c1-3-27(39)35-17-21-16-25(38-37-21)30-28(23-7-5-20(33)15-26(23)42-12-11-41-2)31-24(9-13-43-31)29(36-30)19-4-6-22-18(14-19)8-10-34-32(22)40/h3-7,9,13-16H,1,8,10-12,17H2,2H3,(H,34,40)(H,35,39)(H,37,38) |
| InChIKey | CTXNZFHVMIGQPF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|