C33H28F2N6O3S — CID 169134970
6-[7-(4-fluoro-2-propan-2-yloxyphenyl)-6-[7-(2-fluoroprop-2-enoyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]thieno[3,2-c]pyridin-4-yl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 169134970) has the molecular formula C33H28F2N6O3S and a molecular weight of 626.69 g/mol. Its IUPAC name is 6-[7-(4-fluoro-2-propan-2-yloxyphenyl)-6-[7-(2-fluoroprop-2-enoyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]thieno[3,2-c]pyridin-4-yl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[7-(4-fluoro-2-propan-2-yloxyphenyl)-6-[7-(2-fluoroprop-2-enoyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]thieno[3,2-c]pyridin-4-yl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 169134970 |
| Molecular Formula | C33H28F2N6O3S |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 6-[7-(4-fluoro-2-propan-2-yloxyphenyl)-6-[7-(2-fluoroprop-2-enoyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]thieno[3,2-c]pyridin-4-yl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | C=C(F)C(=O)N1CCn2nc(-c3nc(-c4ccc5c(c4)CCNC5=O)c4ccsc4c3-c3ccc(F)cc3OC(C)C)nc2C1 |
| InChI | InChI=1S/C33H28F2N6O3S/c1-17(2)44-25-15-21(35)5-7-23(25)27-29(31-37-26-16-40(33(43)18(3)34)11-12-41(26)39-31)38-28(24-9-13-45-30(24)27)20-4-6-22-19(14-20)8-10-36-32(22)42/h4-7,9,13-15,17H,3,8,10-12,16H2,1-2H3,(H,36,42) |
| InChIKey | GDGNVJXHMISFKA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|