C29H32F4N4O5S2 — CID 169134937
ethane;[7-(4-fluoro-2-propan-2-yloxyphenyl)-6-(5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)thieno[3,2-c]pyridin-4-yl] trifluoromethanesulfonate;prop-2-enal (PubChem CID 169134937) has the molecular formula C29H32F4N4O5S2 and a molecular weight of 656.72 g/mol. Its IUPAC name is ethane;[7-(4-fluoro-2-propan-2-yloxyphenyl)-6-(5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)thieno[3,2-c]pyridin-4-yl] trifluoromethanesulfonate;prop-2-enal.
| Compound Name | ethane;[7-(4-fluoro-2-propan-2-yloxyphenyl)-6-(5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)thieno[3,2-c]pyridin-4-yl] trifluoromethanesulfonate;prop-2-enal |
|---|---|
| PubChem CID | 169134937 |
| Molecular Formula | C29H32F4N4O5S2 |
| Molecular Weight | 656.72 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | ethane;[7-(4-fluoro-2-propan-2-yloxyphenyl)-6-(5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)thieno[3,2-c]pyridin-4-yl] trifluoromethanesulfonate;prop-2-enal |
| SMILES | C=CC=O.CC.CC(C)Oc1cc(F)ccc1-c1c(-c2cc3n(n2)CCN(C)C3)nc(OS(=O)(=O)C(F)(F)F)c2ccsc12 |
| InChI | InChI=1S/C24H22F4N4O4S2.C3H4O.C2H6/c1-13(2)35-19-10-14(25)4-5-16(19)20-21(18-11-15-12-31(3)7-8-32(15)30-18)29-23(17-6-9-37-22(17)20)36-38(33,34)24(26,27)28;1-2-3-4;1-2/h4-6,9-11,13H,7-8,12H2,1-3H3;2-3H,1H2;1-2H3 |
| InChIKey | PUMBAEAGMFXSDZ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.72 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|