C30H31F5N4O7S2 — CID 169134951
tert-butyl 2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(trifluoromethylsulfonyloxy)thieno[3,2-c]pyridin-6-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 169134951) has the molecular formula C30H31F5N4O7S2 and a molecular weight of 718.72 g/mol. Its IUPAC name is tert-butyl 2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(trifluoromethylsulfonyloxy)thieno[3,2-c]pyridin-6-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | tert-butyl 2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(trifluoromethylsulfonyloxy)thieno[3,2-c]pyridin-6-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 169134951 |
| Molecular Formula | C30H31F5N4O7S2 |
| Molecular Weight | 718.72 g/mol |
| Exact Mass | 718.16 |
| IUPAC Name | tert-butyl 2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(trifluoromethylsulfonyloxy)thieno[3,2-c]pyridin-6-yl]-4,7-dimethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | COCCOc1cc(F)cc(F)c1-c1c(-c2cc3n(n2)C(C)CN(C(=O)OC(C)(C)C)C3C)nc(OS(=O)(=O)C(F)(F)F)c2ccsc12 |
| InChI | InChI=1S/C30H31F5N4O7S2/c1-15-14-38(28(40)45-29(3,4)5)16(2)21-13-20(37-39(15)21)25-24(23-19(32)11-17(31)12-22(23)44-9-8-43-6)26-18(7-10-47-26)27(36-25)46-48(41,42)30(33,34)35/h7,10-13,15-16H,8-9,14H2,1-6H3 |
| InChIKey | IFMXDPUSFRURFX-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 122.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.72 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|