C30H28F6N4O7S — CID 176703098
tert-butyl 2-[4-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-8-fluoro-1-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 176703098) has the molecular formula C30H28F6N4O7S and a molecular weight of 702.63 g/mol. Its IUPAC name is tert-butyl 2-[4-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-8-fluoro-1-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | tert-butyl 2-[4-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-8-fluoro-1-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 176703098 |
| Molecular Formula | C30H28F6N4O7S |
| Molecular Weight | 702.63 g/mol |
| Exact Mass | 702.16 |
| IUPAC Name | tert-butyl 2-[4-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-8-fluoro-1-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | COCCOc1cc(F)cc(F)c1-c1c(-c2cc3n(n2)CCN(C(=O)OC(C)(C)C)C3)nc(OS(=O)(=O)C(F)(F)F)c2c(F)cccc12 |
| InChI | InChI=1S/C30H28F6N4O7S/c1-29(2,3)46-28(41)39-8-9-40-17(15-39)14-21(38-40)26-24(25-20(33)12-16(31)13-22(25)45-11-10-44-4)18-6-5-7-19(32)23(18)27(37-26)47-48(42,43)30(34,35)36/h5-7,12-14H,8-11,15H2,1-4H3 |
| InChIKey | OHGHQWMYQRJGRD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 122.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|