C26H21F4N3O6S3 — CID 169134751
[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(5-prop-2-enoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)thieno[3,2-c]pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 169134751) has the molecular formula C26H21F4N3O6S3 and a molecular weight of 643.66 g/mol. Its IUPAC name is [7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(5-prop-2-enoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)thieno[3,2-c]pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(5-prop-2-enoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)thieno[3,2-c]pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169134751 |
| Molecular Formula | C26H21F4N3O6S3 |
| Molecular Weight | 643.66 g/mol |
| Exact Mass | 643.05 |
| IUPAC Name | [7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-6-(5-prop-2-enoyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)thieno[3,2-c]pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | C=CC(=O)N1CCc2nc(-c3nc(OS(=O)(=O)C(F)(F)F)c4ccsc4c3-c3ccc(F)cc3OCCOC)sc2C1 |
| InChI | InChI=1S/C26H21F4N3O6S3/c1-3-20(34)33-8-6-17-19(13-33)41-25(31-17)22-21(15-5-4-14(27)12-18(15)38-10-9-37-2)23-16(7-11-40-23)24(32-22)39-42(35,36)26(28,29)30/h3-5,7,11-12H,1,6,8-10,13H2,2H3 |
| InChIKey | MHYJHXNMXLBFRQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|