C32H24F2N4O4S2 — CID 169133939
1-[2-[4-(1,3-benzoxazol-5-yl)-7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one (PubChem CID 169133939) has the molecular formula C32H24F2N4O4S2 and a molecular weight of 630.70 g/mol. Its IUPAC name is 1-[2-[4-(1,3-benzoxazol-5-yl)-7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[4-(1,3-benzoxazol-5-yl)-7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169133939 |
| Molecular Formula | C32H24F2N4O4S2 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | 1-[2-[4-(1,3-benzoxazol-5-yl)-7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2nc(-c3nc(-c4ccc5ocnc5c4)c4ccsc4c3-c3c(F)cc(F)cc3OCCOC)sc2C1 |
| InChI | InChI=1S/C32H24F2N4O4S2/c1-3-26(39)38-8-6-21-25(15-38)44-32(36-21)30-28(27-20(34)13-18(33)14-24(27)41-10-9-40-2)31-19(7-11-43-31)29(37-30)17-4-5-23-22(12-17)35-16-42-23/h3-5,7,11-14,16H,1,6,8-10,15H2,2H3 |
| InChIKey | TYQJWFPMVUAFBB-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|