C44H36FN3O4S2 — CID 176827767
1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-trityloxythieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one (PubChem CID 176827767) has the molecular formula C44H36FN3O4S2 and a molecular weight of 753.92 g/mol. Its IUPAC name is 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-trityloxythieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-trityloxythieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176827767 |
| Molecular Formula | C44H36FN3O4S2 |
| Molecular Weight | 753.92 g/mol |
| Exact Mass | 753.21 |
| IUPAC Name | 1-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-trityloxythieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2nc(-c3nc(OC(c4ccccc4)(c4ccccc4)c4ccccc4)c4ccsc4c3-c3ccc(F)cc3OCCOC)sc2C1 |
| InChI | InChI=1S/C44H36FN3O4S2/c1-3-38(49)48-23-21-35-37(28-48)54-43(46-35)40-39(33-20-19-32(45)27-36(33)51-25-24-50-2)41-34(22-26-53-41)42(47-40)52-44(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h3-20,22,26-27H,1,21,23-25,28H2,2H3 |
| InChIKey | PCYHTUCCRXHHQG-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.92 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|