C34H30F2N4O2S2 — CID 169134787
1-[2-[7-(2-ethoxy-4,6-difluorophenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one (PubChem CID 169134787) has the molecular formula C34H30F2N4O2S2 and a molecular weight of 628.77 g/mol. Its IUPAC name is 1-[2-[7-(2-ethoxy-4,6-difluorophenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[7-(2-ethoxy-4,6-difluorophenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169134787 |
| Molecular Formula | C34H30F2N4O2S2 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | 1-[2-[7-(2-ethoxy-4,6-difluorophenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2nc(-c3nc(-c4ccc5c(c4)CCN(C)C5)c4ccsc4c3-c3c(F)cc(F)cc3OCC)sc2C1 |
| InChI | InChI=1S/C34H30F2N4O2S2/c1-4-28(41)40-12-9-25-27(18-40)44-34(37-25)32-30(29-24(36)15-22(35)16-26(29)42-5-2)33-23(10-13-43-33)31(38-32)20-6-7-21-17-39(3)11-8-19(21)14-20/h4,6-7,10,13-16H,1,5,8-9,11-12,17-18H2,2-3H3 |
| InChIKey | AZCQNRMIEJCZNV-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|