C36H31F2N3O4S — CID 169135981
1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-[(3S)-3-hydroxy-2,3-dihydro-1H-inden-5-yl]thieno[3,2-c]pyridin-6-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]prop-2-en-1-one (PubChem CID 169135981) has the molecular formula C36H31F2N3O4S and a molecular weight of 639.72 g/mol. Its IUPAC name is 1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-[(3S)-3-hydroxy-2,3-dihydro-1H-inden-5-yl]thieno[3,2-c]pyridin-6-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-[(3S)-3-hydroxy-2,3-dihydro-1H-inden-5-yl]thieno[3,2-c]pyridin-6-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169135981 |
| Molecular Formula | C36H31F2N3O4S |
| Molecular Weight | 639.72 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | 1-[3-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-[(3S)-3-hydroxy-2,3-dihydro-1H-inden-5-yl]thieno[3,2-c]pyridin-6-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ncc(-c3nc(-c4ccc5c(c4)[C@@H](O)CC5)c4ccsc4c3-c3c(F)cc(F)cc3OCCOC)cc2C1 |
| InChI | InChI=1S/C36H31F2N3O4S/c1-3-31(43)41-10-8-28-23(19-41)14-22(18-39-28)35-33(32-27(38)16-24(37)17-30(32)45-12-11-44-2)36-25(9-13-46-36)34(40-35)21-5-4-20-6-7-29(42)26(20)15-21/h3-5,9,13-18,29,42H,1,6-8,10-12,19H2,2H3/t29-/m0/s1 |
| InChIKey | AHYOKWFBACPXFW-LJAQVGFWSA-N |
| XLogP | 7.05 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|