C22H20FN3O2S2 — CID 169134764
2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 169134764) has the molecular formula C22H20FN3O2S2 and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 169134764 |
| Molecular Formula | C22H20FN3O2S2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]thieno[3,2-c]pyridin-6-yl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2nc3c(s2)CNCC3)ncc2ccsc12 |
| InChI | InChI=1S/C22H20FN3O2S2/c1-27-7-8-28-17-10-14(23)2-3-15(17)19-20(25-11-13-5-9-29-21(13)19)22-26-16-4-6-24-12-18(16)30-22/h2-3,5,9-11,24H,4,6-8,12H2,1H3 |
| InChIKey | YBCOICXRRDKZPC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|