C19H17F4N3O4S — CID 172557613
[3-(4-fluoro-2-propan-2-yloxyphenyl)-6-(1-methylpyrazol-4-yl)-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 172557613) has the molecular formula C19H17F4N3O4S and a molecular weight of 459.42 g/mol. Its IUPAC name is [3-(4-fluoro-2-propan-2-yloxyphenyl)-6-(1-methylpyrazol-4-yl)-2-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [3-(4-fluoro-2-propan-2-yloxyphenyl)-6-(1-methylpyrazol-4-yl)-2-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172557613 |
| Molecular Formula | C19H17F4N3O4S |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [3-(4-fluoro-2-propan-2-yloxyphenyl)-6-(1-methylpyrazol-4-yl)-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | CC(C)Oc1cc(F)ccc1-c1ccc(-c2cnn(C)c2)nc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H17F4N3O4S/c1-11(2)29-17-8-13(20)4-5-14(17)15-6-7-16(12-9-24-26(3)10-12)25-18(15)30-31(27,28)19(21,22)23/h4-11H,1-3H3 |
| InChIKey | OKAYOVBNPGSFJS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|