C12H10F3N5O3S — CID 130311895
[5-methyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate (PubChem CID 130311895) has the molecular formula C12H10F3N5O3S and a molecular weight of 361.31 g/mol. Its IUPAC name is [5-methyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-methyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130311895 |
| Molecular Formula | C12H10F3N5O3S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | [5-methyl-7-(1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(-c2cnn(C)c2)n2nc(OS(=O)(=O)C(F)(F)F)ncc12 |
| InChI | InChI=1S/C12H10F3N5O3S/c1-7-3-9(8-4-17-19(2)6-8)20-10(7)5-16-11(18-20)23-24(21,22)12(13,14)15/h3-6H,1-2H3 |
| InChIKey | IRVYPYBJMHALMW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|