C9H6F6O6S2 — CID 87426255
[3-methyl-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 87426255) has the molecular formula C9H6F6O6S2 and a molecular weight of 388.26 g/mol. Its IUPAC name is [3-methyl-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-methyl-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87426255 |
| Molecular Formula | C9H6F6O6S2 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | [3-methyl-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F6O6S2/c1-5-2-6(20-22(16,17)8(10,11)12)4-7(3-5)21-23(18,19)9(13,14)15/h2-4H,1H3 |
| InChIKey | VTFJWRAPYHOZGP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|