C17H19F3NO3S+ — CID 58731389
[3,5-dimethyl-4-(1,3,5-trimethylpyridin-1-ium-4-yl)phenyl] trifluoromethanesulfonate (PubChem CID 58731389) has the molecular formula C17H19F3NO3S+ and a molecular weight of 374.40 g/mol. Its IUPAC name is [3,5-dimethyl-4-(1,3,5-trimethylpyridin-1-ium-4-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dimethyl-4-(1,3,5-trimethylpyridin-1-ium-4-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58731389 |
| Molecular Formula | C17H19F3NO3S+ |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [3,5-dimethyl-4-(1,3,5-trimethylpyridin-1-ium-4-yl)phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(C)c1-c1c(C)c[n+](C)cc1C |
| InChI | InChI=1S/C17H19F3NO3S/c1-10-6-14(24-25(22,23)17(18,19)20)7-11(2)15(10)16-12(3)8-21(5)9-13(16)4/h6-9H,1-5H3/q+1 |
| InChIKey | PCBKYTDNLNNUHX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|