C8H5F6NO6S2 — CID 134590456
[2-methyl-6-(trifluoromethylsulfonyloxy)-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 134590456) has the molecular formula C8H5F6NO6S2 and a molecular weight of 389.25 g/mol. Its IUPAC name is [2-methyl-6-(trifluoromethylsulfonyloxy)-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [2-methyl-6-(trifluoromethylsulfonyloxy)-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134590456 |
| Molecular Formula | C8H5F6NO6S2 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | [2-methyl-6-(trifluoromethylsulfonyloxy)-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(OS(=O)(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H5F6NO6S2/c1-4-2-5(20-22(16,17)7(9,10)11)3-6(15-4)21-23(18,19)8(12,13)14/h2-3H,1H3 |
| InChIKey | FFROSPMRHKFVHN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|