C10H8F3NO7S — CID 10712378
dimethyl 4-(trifluoromethylsulfonyloxy)pyridine-2,6-dicarboxylate (PubChem CID 10712378) has the molecular formula C10H8F3NO7S and a molecular weight of 343.24 g/mol. Its IUPAC name is dimethyl 4-(trifluoromethylsulfonyloxy)pyridine-2,6-dicarboxylate.
| Compound Name | dimethyl 4-(trifluoromethylsulfonyloxy)pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10712378 |
| Molecular Formula | C10H8F3NO7S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | dimethyl 4-(trifluoromethylsulfonyloxy)pyridine-2,6-dicarboxylate |
| SMILES | COC(=O)c1cc(OS(=O)(=O)C(F)(F)F)cc(C(=O)OC)n1 |
| InChI | InChI=1S/C10H8F3NO7S/c1-19-8(15)6-3-5(4-7(14-6)9(16)20-2)21-22(17,18)10(11,12)13/h3-4H,1-2H3 |
| InChIKey | BJPDBTTVJBUBFD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|