C14H11F3O5S — CID 121442605
methyl 7-methyl-3-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate (PubChem CID 121442605) has the molecular formula C14H11F3O5S and a molecular weight of 348.30 g/mol. Its IUPAC name is methyl 7-methyl-3-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate.
| Compound Name | methyl 7-methyl-3-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 121442605 |
| Molecular Formula | C14H11F3O5S |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | methyl 7-methyl-3-(trifluoromethylsulfonyloxy)naphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(C)ccc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H11F3O5S/c1-8-3-4-9-7-12(22-23(19,20)14(15,16)17)11(13(18)21-2)6-10(9)5-8/h3-7H,1-2H3 |
| InChIKey | NPISJDGPNXQTCX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|