C28H15F3O5S — CID 158081401
(23-methyl-14,28-dioxaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1,3(15),4(13),5,7,9,11,16,18(27),19,21,23,25-tridecaen-9-yl) trifluoromethanesulfonate (PubChem CID 158081401) has the molecular formula C28H15F3O5S and a molecular weight of 520.48 g/mol. Its IUPAC name is (23-methyl-14,28-dioxaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1,3(15),4(13),5,7,9,11,16,18(27),19,21,23,25-tridecaen-9-yl) trifluoromethanesulfonate.
| Compound Name | (23-methyl-14,28-dioxaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1,3(15),4(13),5,7,9,11,16,18(27),19,21,23,25-tridecaen-9-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158081401 |
| Molecular Formula | C28H15F3O5S |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | (23-methyl-14,28-dioxaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1,3(15),4(13),5,7,9,11,16,18(27),19,21,23,25-tridecaen-9-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2cc3c(cc2c1)oc1cc2c(cc13)oc1cc3cc(OS(=O)(=O)C(F)(F)F)ccc3cc12 |
| InChI | InChI=1S/C28H15F3O5S/c1-14-2-3-15-8-20-22-12-27-23(13-26(22)34-24(20)10-17(15)6-14)21-9-16-4-5-19(7-18(16)11-25(21)35-27)36-37(32,33)28(29,30)31/h2-13H,1H3 |
| InChIKey | UOTIJNWQJNGUPY-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|