C20H19F3O3SSi — CID 169293670
[7-(4-trimethylsilylphenyl)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 169293670) has the molecular formula C20H19F3O3SSi and a molecular weight of 424.52 g/mol. Its IUPAC name is [7-(4-trimethylsilylphenyl)naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [7-(4-trimethylsilylphenyl)naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169293670 |
| Molecular Formula | C20H19F3O3SSi |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | [7-(4-trimethylsilylphenyl)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc3ccc(OS(=O)(=O)C(F)(F)F)cc3c2)cc1 |
| InChI | InChI=1S/C20H19F3O3SSi/c1-28(2,3)19-10-7-14(8-11-19)16-5-4-15-6-9-18(13-17(15)12-16)26-27(24,25)20(21,22)23/h4-13H,1-3H3 |
| InChIKey | VLTMVOGRLUJRSY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|