C38H31F3Si — CID 169293833
trimethyl-[4-[4-[7-[4-[4-(trifluoromethyl)phenyl]phenyl]naphthalen-2-yl]phenyl]phenyl]silane (PubChem CID 169293833) has the molecular formula C38H31F3Si and a molecular weight of 572.75 g/mol. Its IUPAC name is trimethyl-[4-[4-[7-[4-[4-(trifluoromethyl)phenyl]phenyl]naphthalen-2-yl]phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-[7-[4-[4-(trifluoromethyl)phenyl]phenyl]naphthalen-2-yl]phenyl]phenyl]silane |
|---|---|
| PubChem CID | 169293833 |
| Molecular Formula | C38H31F3Si |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | trimethyl-[4-[4-[7-[4-[4-(trifluoromethyl)phenyl]phenyl]naphthalen-2-yl]phenyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3ccc4ccc(-c5ccc(-c6ccc(C(F)(F)F)cc6)cc5)cc4c3)cc2)cc1 |
| InChI | InChI=1S/C38H31F3Si/c1-42(2,3)37-22-18-29(19-23-37)27-6-10-31(11-7-27)34-15-13-32-12-14-33(24-35(32)25-34)30-8-4-26(5-9-30)28-16-20-36(21-17-28)38(39,40)41/h4-25H,1-3H3 |
| InChIKey | LVOSNVKPQQSVBK-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|