C54H51F9Si3 — CID 102366685
trimethyl-[4-[2,4,6-tris[4-(trifluoromethyl)phenyl]-3,5-bis(4-trimethylsilylphenyl)phenyl]phenyl]silane (PubChem CID 102366685) has the molecular formula C54H51F9Si3 and a molecular weight of 955.24 g/mol. Its IUPAC name is trimethyl-[4-[2,4,6-tris[4-(trifluoromethyl)phenyl]-3,5-bis(4-trimethylsilylphenyl)phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[2,4,6-tris[4-(trifluoromethyl)phenyl]-3,5-bis(4-trimethylsilylphenyl)phenyl]phenyl]silane |
|---|---|
| PubChem CID | 102366685 |
| Molecular Formula | C54H51F9Si3 |
| Molecular Weight | 955.24 g/mol |
| Exact Mass | 954.32 |
| IUPAC Name | trimethyl-[4-[2,4,6-tris[4-(trifluoromethyl)phenyl]-3,5-bis(4-trimethylsilylphenyl)phenyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2c(-c3ccc(C(F)(F)F)cc3)c(-c3ccc([Si](C)(C)C)cc3)c(-c3ccc(C(F)(F)F)cc3)c(-c3ccc([Si](C)(C)C)cc3)c2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C54H51F9Si3/c1-64(2,3)43-28-16-37(17-29-43)49-46(34-10-22-40(23-11-34)52(55,56)57)50(38-18-30-44(31-19-38)65(4,5)6)48(36-14-26-42(27-15-36)54(61,62)63)51(39-20-32-45(33-21-39)66(7,8)9)47(49)35-12-24-41(25-13-35)53(58,59)60/h10-33H,1-9H3 |
| InChIKey | LXZRXAWBKIQGEL-UHFFFAOYSA-N |
| XLogP | 16.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.24 |
| LogP ≤ 5 | 16.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|