C37H30F3NSi — CID 169293948
trimethyl-[4-[4-[3-[4-[4-(trifluoromethyl)phenyl]phenyl]quinolin-7-yl]phenyl]phenyl]silane (PubChem CID 169293948) has the molecular formula C37H30F3NSi and a molecular weight of 573.73 g/mol. Its IUPAC name is trimethyl-[4-[4-[3-[4-[4-(trifluoromethyl)phenyl]phenyl]quinolin-7-yl]phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-[3-[4-[4-(trifluoromethyl)phenyl]phenyl]quinolin-7-yl]phenyl]phenyl]silane |
|---|---|
| PubChem CID | 169293948 |
| Molecular Formula | C37H30F3NSi |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | trimethyl-[4-[4-[3-[4-[4-(trifluoromethyl)phenyl]phenyl]quinolin-7-yl]phenyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3ccc4cc(-c5ccc(-c6ccc(C(F)(F)F)cc6)cc5)cnc4c3)cc2)cc1 |
| InChI | InChI=1S/C37H30F3NSi/c1-42(2,3)35-20-16-28(17-21-35)26-4-8-29(9-5-26)31-12-13-32-22-33(24-41-36(32)23-31)30-10-6-25(7-11-30)27-14-18-34(19-15-27)37(38,39)40/h4-24H,1-3H3 |
| InChIKey | ADIXRVDZKWRBSJ-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|