C24H35F3Si3 — CID 177431862
trimethyl-[(1E,3Z,5Z,7Z)-2-[4-(trifluoromethyl)phenyl]-3,4-bis(trimethylsilyl)cycloocta-1,3,5,7-tetraen-1-yl]silane (PubChem CID 177431862) has the molecular formula C24H35F3Si3 and a molecular weight of 464.80 g/mol. Its IUPAC name is trimethyl-[(1E,3Z,5Z,7Z)-2-[4-(trifluoromethyl)phenyl]-3,4-bis(trimethylsilyl)cycloocta-1,3,5,7-tetraen-1-yl]silane.
| Compound Name | trimethyl-[(1E,3Z,5Z,7Z)-2-[4-(trifluoromethyl)phenyl]-3,4-bis(trimethylsilyl)cycloocta-1,3,5,7-tetraen-1-yl]silane |
|---|---|
| PubChem CID | 177431862 |
| Molecular Formula | C24H35F3Si3 |
| Molecular Weight | 464.80 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | trimethyl-[(1E,3Z,5Z,7Z)-2-[4-(trifluoromethyl)phenyl]-3,4-bis(trimethylsilyl)cycloocta-1,3,5,7-tetraen-1-yl]silane |
| SMILES | C[Si](C)(C)C1=C([Si](C)(C)C)/C(c2ccc(C(F)(F)F)cc2)=C([Si](C)(C)C)\C=C/C=C\1 |
| InChI | InChI=1S/C24H35F3Si3/c1-28(2,3)20-12-10-11-13-21(29(4,5)6)23(30(7,8)9)22(20)18-14-16-19(17-15-18)24(25,26)27/h10-17H,1-9H3/b11-10-,12-10-,13-11-,20-12+,21-13+,22-20+,23-21-,23-22+ |
| InChIKey | XFUUNLFKQWOQSZ-VJBNRIDDSA-N |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.80 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|