C14H24F3NSi2 — CID 100995079
1-[4-(trifluoromethyl)phenyl]-N,N-bis(trimethylsilyl)methanamine (PubChem CID 100995079) has the molecular formula C14H24F3NSi2 and a molecular weight of 319.52 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-N,N-bis(trimethylsilyl)methanamine.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-N,N-bis(trimethylsilyl)methanamine |
|---|---|
| PubChem CID | 100995079 |
| Molecular Formula | C14H24F3NSi2 |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-N,N-bis(trimethylsilyl)methanamine |
| SMILES | C[Si](C)(C)N(Cc1ccc(C(F)(F)F)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H24F3NSi2/c1-19(2,3)18(20(4,5)6)11-12-7-9-13(10-8-12)14(15,16)17/h7-10H,11H2,1-6H3 |
| InChIKey | DDJLQBCQSDLCCD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|