C34H28F12N2 — CID 139171038
N,N,N',N'-tetrakis[[4-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 139171038) has the molecular formula C34H28F12N2 and a molecular weight of 692.59 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[[4-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis[[4-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 139171038 |
| Molecular Formula | C34H28F12N2 |
| Molecular Weight | 692.59 g/mol |
| Exact Mass | 692.21 |
| IUPAC Name | N,N,N',N'-tetrakis[[4-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | FC(F)(F)c1ccc(CN(CCN(Cc2ccc(C(F)(F)F)cc2)Cc2ccc(C(F)(F)F)cc2)Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H28F12N2/c35-31(36,37)27-9-1-23(2-10-27)19-47(20-24-3-11-28(12-4-24)32(38,39)40)17-18-48(21-25-5-13-29(14-6-25)33(41,42)43)22-26-7-15-30(16-8-26)34(44,45)46/h1-16H,17-22H2 |
| InChIKey | LIBQBESAPCGREW-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.59 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |